About 2-ethylhexyl N-sulfinylcarbamate
2-ethylhexyl N-sulfinylcarbamate (PubChem CID 19777045) has the molecular formula C9H17NO3S
and a molecular weight of 219.31 g/mol. Its IUPAC name is 2-ethylhexyl N-sulfinylcarbamate.
Molecular Properties
| Compound Name | 2-ethylhexyl N-sulfinylcarbamate |
| PubChem CID | 19777045 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-ethylhexyl N-sulfinylcarbamate |
| SMILES | CCCCC(CC)COC(=O)N=S=O |
| InChI | InChI=1S/C9H17NO3S/c1-3-5-6-8(4-2)7-13-9(11)10-14-12/h8H,3-7H2,1-2H3 |
| InChIKey | MGYOMIMFIHOQSR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethylhexyl N-sulfinylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl N-sulfinylcarbamate?
The IUPAC name of 2-ethylhexyl N-sulfinylcarbamate (CID 19777045) is 2-ethylhexyl N-sulfinylcarbamate.
What is the SMILES notation for 2-ethylhexyl N-sulfinylcarbamate?
The canonical SMILES for 2-ethylhexyl N-sulfinylcarbamate is CCCCC(CC)COC(=O)N=S=O.
What is the InChIKey of 2-ethylhexyl N-sulfinylcarbamate?
The InChIKey is MGYOMIMFIHOQSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3S/c1-3-5-6-8(4-2)7-13-9(11)10-14-12/h8H,3-7H2,1-2H3.
What are the key properties of 2-ethylhexyl N-sulfinylcarbamate?
2-ethylhexyl N-sulfinylcarbamate has a molecular weight of 219.31 g/mol, XLogP of 2.74, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl N-sulfinylcarbamate is sourced from PubChem (CID 19777045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).