C13H4BrF6N3O2 — CID 19779375
3-bromo-2-[6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-5-(trifluoromethoxy)benzonitrile (PubChem CID 19779375) has the molecular formula C13H4BrF6N3O2 and a molecular weight of 428.09 g/mol. Its IUPAC name is 3-bromo-2-[6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-5-(trifluoromethoxy)benzonitrile.
| Compound Name | 3-bromo-2-[6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-5-(trifluoromethoxy)benzonitrile |
|---|---|
| PubChem CID | 19779375 |
| Molecular Formula | C13H4BrF6N3O2 |
| Molecular Weight | 428.09 g/mol |
| Exact Mass | 426.94 |
| IUPAC Name | 3-bromo-2-[6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-5-(trifluoromethoxy)benzonitrile |
| SMILES | N#Cc1cc(OC(F)(F)F)cc(Br)c1-n1cnc(C(F)(F)F)cc1=O |
| InChI | InChI=1S/C13H4BrF6N3O2/c14-8-2-7(25-13(18,19)20)1-6(4-21)11(8)23-5-22-9(3-10(23)24)12(15,16)17/h1-3,5H |
| InChIKey | ROZSNCZBWSWUNY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.09 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |