C14H4F9N3O — CID 19819655
3-fluoro-2-[6-oxo-4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-1-yl]-5-(trifluoromethyl)benzonitrile (PubChem CID 19819655) has the molecular formula C14H4F9N3O and a molecular weight of 401.19 g/mol. Its IUPAC name is 3-fluoro-2-[6-oxo-4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-1-yl]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 3-fluoro-2-[6-oxo-4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-1-yl]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 19819655 |
| Molecular Formula | C14H4F9N3O |
| Molecular Weight | 401.19 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 3-fluoro-2-[6-oxo-4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-1-yl]-5-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(C(F)(F)F)cc(F)c1-n1cnc(C(F)(F)C(F)(F)F)cc1=O |
| InChI | InChI=1S/C14H4F9N3O/c15-8-2-7(13(18,19)20)1-6(4-24)11(8)26-5-25-9(3-10(26)27)12(16,17)14(21,22)23/h1-3,5H |
| InChIKey | RGXYRACFUQCPGT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.19 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|