C14H4F10N2 — CID 11406632
bis[2,6-difluoro-4-(trifluoromethyl)phenyl]diazene (PubChem CID 11406632) has the molecular formula C14H4F10N2 and a molecular weight of 390.18 g/mol. Its IUPAC name is bis[2,6-difluoro-4-(trifluoromethyl)phenyl]diazene.
| Compound Name | bis[2,6-difluoro-4-(trifluoromethyl)phenyl]diazene |
|---|---|
| PubChem CID | 11406632 |
| Molecular Formula | C14H4F10N2 |
| Molecular Weight | 390.18 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | bis[2,6-difluoro-4-(trifluoromethyl)phenyl]diazene |
| SMILES | Fc1cc(C(F)(F)F)cc(F)c1/N=N/c1c(F)cc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C14H4F10N2/c15-7-1-5(13(19,20)21)2-8(16)11(7)25-26-12-9(17)3-6(4-10(12)18)14(22,23)24/h1-4H/b26-25+ |
| InChIKey | LTNQWMGBFBSMRE-OCEACIFDSA-N |
| XLogP | 6.70 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.18 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|