C7H2F6N2 — CID 13219936
trifluoromethyl-(2,4,6-trifluorophenyl)diazene (PubChem CID 13219936) has the molecular formula C7H2F6N2 and a molecular weight of 228.09 g/mol. Its IUPAC name is trifluoromethyl-(2,4,6-trifluorophenyl)diazene.
| Compound Name | trifluoromethyl-(2,4,6-trifluorophenyl)diazene |
|---|---|
| PubChem CID | 13219936 |
| Molecular Formula | C7H2F6N2 |
| Molecular Weight | 228.09 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | trifluoromethyl-(2,4,6-trifluorophenyl)diazene |
| SMILES | Fc1cc(F)c(/N=N/C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C7H2F6N2/c8-3-1-4(9)6(5(10)2-3)14-15-7(11,12)13/h1-2H/b15-14+ |
| InChIKey | GZBVTZOYUZLTDM-CCEZHUSRSA-N |
| XLogP | 3.71 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.09 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|