C8H3ClF6 — CID 61083934
2-(1-chloro-2,2,2-trifluoroethyl)-1,3,5-trifluorobenzene (PubChem CID 61083934) has the molecular formula C8H3ClF6 and a molecular weight of 248.55 g/mol. Its IUPAC name is 2-(1-chloro-2,2,2-trifluoroethyl)-1,3,5-trifluorobenzene.
| Compound Name | 2-(1-chloro-2,2,2-trifluoroethyl)-1,3,5-trifluorobenzene |
|---|---|
| PubChem CID | 61083934 |
| Molecular Formula | C8H3ClF6 |
| Molecular Weight | 248.55 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | 2-(1-chloro-2,2,2-trifluoroethyl)-1,3,5-trifluorobenzene |
| SMILES | Fc1cc(F)c(C(Cl)C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C8H3ClF6/c9-7(8(13,14)15)6-4(11)1-3(10)2-5(6)12/h1-2,7H |
| InChIKey | YQTHUDCONPESER-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|