C9H5ClF6 — CID 61085764
2-(1-chloro-3,3,3-trifluoropropyl)-1,3,5-trifluorobenzene (PubChem CID 61085764) has the molecular formula C9H5ClF6 and a molecular weight of 262.58 g/mol. Its IUPAC name is 2-(1-chloro-3,3,3-trifluoropropyl)-1,3,5-trifluorobenzene.
| Compound Name | 2-(1-chloro-3,3,3-trifluoropropyl)-1,3,5-trifluorobenzene |
|---|---|
| PubChem CID | 61085764 |
| Molecular Formula | C9H5ClF6 |
| Molecular Weight | 262.58 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 2-(1-chloro-3,3,3-trifluoropropyl)-1,3,5-trifluorobenzene |
| SMILES | Fc1cc(F)c(C(Cl)CC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C9H5ClF6/c10-5(3-9(14,15)16)8-6(12)1-4(11)2-7(8)13/h1-2,5H,3H2 |
| InChIKey | KXTWPCLQPHZHKQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|