About 5-chloro-3-[2,6-difluoro-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)pyrimidin-4-one
5-chloro-3-[2,6-difluoro-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)pyrimidin-4-one (PubChem CID 151815045) has the molecular formula C12H3ClF8N2O
and a molecular weight of 378.61 g/mol. Its IUPAC name is 5-chloro-3-[2,6-difluoro-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-chloro-3-[2,6-difluoro-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)pyrimidin-4-one |
| PubChem CID | 151815045 |
| Molecular Formula | C12H3ClF8N2O |
| Molecular Weight | 378.61 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | 5-chloro-3-[2,6-difluoro-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)pyrimidin-4-one |
| SMILES | O=c1c(Cl)c(C(F)(F)F)ncn1-c1c(F)cc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C12H3ClF8N2O/c13-7-9(12(19,20)21)22-3-23(10(7)24)8-5(14)1-4(2-6(8)15)11(16,17)18/h1-3H |
| InChIKey | SBKJZRWCTMHXIK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-3-[2,6-difluoro-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-[2,6-difluoro-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)pyrimidin-4-one?
The IUPAC name of 5-chloro-3-[2,6-difluoro-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)pyrimidin-4-one (CID 151815045) is 5-chloro-3-[2,6-difluoro-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)pyrimidin-4-one.
What is the SMILES notation for 5-chloro-3-[2,6-difluoro-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)pyrimidin-4-one?
The canonical SMILES for 5-chloro-3-[2,6-difluoro-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)pyrimidin-4-one is O=c1c(Cl)c(C(F)(F)F)ncn1-c1c(F)cc(C(F)(F)F)cc1F.
What is the InChIKey of 5-chloro-3-[2,6-difluoro-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)pyrimidin-4-one?
The InChIKey is SBKJZRWCTMHXIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H3ClF8N2O/c13-7-9(12(19,20)21)22-3-23(10(7)24)8-5(14)1-4(2-6(8)15)11(16,17)18/h1-3H.
What are the key properties of 5-chloro-3-[2,6-difluoro-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)pyrimidin-4-one?
5-chloro-3-[2,6-difluoro-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)pyrimidin-4-one has a molecular weight of 378.61 g/mol, XLogP of 4.20, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-[2,6-difluoro-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)pyrimidin-4-one is sourced from PubChem (CID 151815045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).