C18H24N2O8 — CID 19784058
2-[[2-[3-[2-(2-acetyloxyethoxyamino)-2-oxoethyl]phenyl]acetyl]amino]oxyethyl acetate (PubChem CID 19784058) has the molecular formula C18H24N2O8 and a molecular weight of 396.40 g/mol. Its IUPAC name is 2-[[2-[3-[2-(2-acetyloxyethoxyamino)-2-oxoethyl]phenyl]acetyl]amino]oxyethyl acetate.
| Compound Name | 2-[[2-[3-[2-(2-acetyloxyethoxyamino)-2-oxoethyl]phenyl]acetyl]amino]oxyethyl acetate |
|---|---|
| PubChem CID | 19784058 |
| Molecular Formula | C18H24N2O8 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-[[2-[3-[2-(2-acetyloxyethoxyamino)-2-oxoethyl]phenyl]acetyl]amino]oxyethyl acetate |
| SMILES | CC(=O)OCCONC(=O)Cc1cccc(CC(=O)NOCCOC(C)=O)c1 |
| InChI | InChI=1S/C18H24N2O8/c1-13(21)25-6-8-27-19-17(23)11-15-4-3-5-16(10-15)12-18(24)20-28-9-7-26-14(2)22/h3-5,10H,6-9,11-12H2,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | ZWRAIPJAFBUVDF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|