About methyl N-methyl-N-methylsulfonyl-N'-nitrocarbamimidothioate
methyl N-methyl-N-methylsulfonyl-N'-nitrocarbamimidothioate (PubChem CID 19786851) has the molecular formula C4H9N3O4S2
and a molecular weight of 227.27 g/mol. Its IUPAC name is methyl N-methyl-N-methylsulfonyl-N'-nitrocarbamimidothioate.
Molecular Properties
| Compound Name | methyl N-methyl-N-methylsulfonyl-N'-nitrocarbamimidothioate |
| PubChem CID | 19786851 |
| Molecular Formula | C4H9N3O4S2 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | methyl N-methyl-N-methylsulfonyl-N'-nitrocarbamimidothioate |
| SMILES | CS/C(=N\[N+](=O)[O-])N(C)S(C)(=O)=O |
| InChI | InChI=1S/C4H9N3O4S2/c1-6(13(3,10)11)4(12-2)5-7(8)9/h1-3H3/b5-4- |
| InChIKey | UZKOWBMNXLMFQW-PLNGDYQASA-N |
| XLogP | -0.21 |
| TPSA | 92.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl N-methyl-N-methylsulfonyl-N'-nitrocarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-methyl-N-methylsulfonyl-N'-nitrocarbamimidothioate?
The IUPAC name of methyl N-methyl-N-methylsulfonyl-N'-nitrocarbamimidothioate (CID 19786851) is methyl N-methyl-N-methylsulfonyl-N'-nitrocarbamimidothioate.
What is the SMILES notation for methyl N-methyl-N-methylsulfonyl-N'-nitrocarbamimidothioate?
The canonical SMILES for methyl N-methyl-N-methylsulfonyl-N'-nitrocarbamimidothioate is CS/C(=N\[N+](=O)[O-])N(C)S(C)(=O)=O.
What is the InChIKey of methyl N-methyl-N-methylsulfonyl-N'-nitrocarbamimidothioate?
The InChIKey is UZKOWBMNXLMFQW-PLNGDYQASA-N. The full InChI is InChI=1S/C4H9N3O4S2/c1-6(13(3,10)11)4(12-2)5-7(8)9/h1-3H3/b5-4-.
What are the key properties of methyl N-methyl-N-methylsulfonyl-N'-nitrocarbamimidothioate?
methyl N-methyl-N-methylsulfonyl-N'-nitrocarbamimidothioate has a molecular weight of 227.27 g/mol, XLogP of -0.21, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-methyl-N-methylsulfonyl-N'-nitrocarbamimidothioate is sourced from PubChem (CID 19786851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).