C25H44BrN3O4 — CID 19788770
bis(8-methylnonyl) 2-bromo-2-(1,2,4-triazol-1-yl)propanedioate (PubChem CID 19788770) has the molecular formula C25H44BrN3O4 and a molecular weight of 530.55 g/mol. Its IUPAC name is bis(8-methylnonyl) 2-bromo-2-(1,2,4-triazol-1-yl)propanedioate.
| Compound Name | bis(8-methylnonyl) 2-bromo-2-(1,2,4-triazol-1-yl)propanedioate |
|---|---|
| PubChem CID | 19788770 |
| Molecular Formula | C25H44BrN3O4 |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | bis(8-methylnonyl) 2-bromo-2-(1,2,4-triazol-1-yl)propanedioate |
| SMILES | CC(C)CCCCCCCOC(=O)C(Br)(C(=O)OCCCCCCCC(C)C)n1cncn1 |
| InChI | InChI=1S/C25H44BrN3O4/c1-21(2)15-11-7-5-9-13-17-32-23(30)25(26,29-20-27-19-28-29)24(31)33-18-14-10-6-8-12-16-22(3)4/h19-22H,5-18H2,1-4H3 |
| InChIKey | UPPQGAGGVJEBIQ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|