C37H45N3O2Si2 — CID 19794274
[3-azido-2-[tert-butyl(diphenyl)silyl]oxycyclobutyl]methoxy-tert-butyl-diphenylsilane (PubChem CID 19794274) has the molecular formula C37H45N3O2Si2 and a molecular weight of 619.96 g/mol. Its IUPAC name is [3-azido-2-[tert-butyl(diphenyl)silyl]oxycyclobutyl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [3-azido-2-[tert-butyl(diphenyl)silyl]oxycyclobutyl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 19794274 |
| Molecular Formula | C37H45N3O2Si2 |
| Molecular Weight | 619.96 g/mol |
| Exact Mass | 619.31 |
| IUPAC Name | [3-azido-2-[tert-butyl(diphenyl)silyl]oxycyclobutyl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCC1CC(N=[N+]=[N-])C1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H45N3O2Si2/c1-36(2,3)43(30-19-11-7-12-20-30,31-21-13-8-14-22-31)41-28-29-27-34(39-40-38)35(29)42-44(37(4,5)6,32-23-15-9-16-24-32)33-25-17-10-18-26-33/h7-26,29,34-35H,27-28H2,1-6H3 |
| InChIKey | SVDUNBGEJNVKFS-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.96 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|