C20H19F3N2O3 — CID 19796739
methyl 2-(5-methoxy-1H-indol-3-yl)-2-[N-methyl-3-(trifluoromethyl)anilino]acetate (PubChem CID 19796739) has the molecular formula C20H19F3N2O3 and a molecular weight of 392.38 g/mol. Its IUPAC name is methyl 2-(5-methoxy-1H-indol-3-yl)-2-[N-methyl-3-(trifluoromethyl)anilino]acetate.
| Compound Name | methyl 2-(5-methoxy-1H-indol-3-yl)-2-[N-methyl-3-(trifluoromethyl)anilino]acetate |
|---|---|
| PubChem CID | 19796739 |
| Molecular Formula | C20H19F3N2O3 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | methyl 2-(5-methoxy-1H-indol-3-yl)-2-[N-methyl-3-(trifluoromethyl)anilino]acetate |
| SMILES | COC(=O)C(c1c[nH]c2ccc(OC)cc12)N(C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F3N2O3/c1-25(13-6-4-5-12(9-13)20(21,22)23)18(19(26)28-3)16-11-24-17-8-7-14(27-2)10-15(16)17/h4-11,18,24H,1-3H3 |
| InChIKey | QSZIWNQAEDFGAG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |