C18H17F3N2O — CID 75365778
2-(5-methoxy-1H-indol-3-yl)-2-[3-(trifluoromethyl)phenyl]ethanamine (PubChem CID 75365778) has the molecular formula C18H17F3N2O and a molecular weight of 334.34 g/mol. Its IUPAC name is 2-(5-methoxy-1H-indol-3-yl)-2-[3-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 2-(5-methoxy-1H-indol-3-yl)-2-[3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 75365778 |
| Molecular Formula | C18H17F3N2O |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-(5-methoxy-1H-indol-3-yl)-2-[3-(trifluoromethyl)phenyl]ethanamine |
| SMILES | COc1ccc2[nH]cc(C(CN)c3cccc(C(F)(F)F)c3)c2c1 |
| InChI | InChI=1S/C18H17F3N2O/c1-24-13-5-6-17-14(8-13)16(10-23-17)15(9-22)11-3-2-4-12(7-11)18(19,20)21/h2-8,10,15,23H,9,22H2,1H3 |
| InChIKey | DRIYETNDXNERDA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |