C19H17F3N2O3 — CID 70356145
2-[(5-methoxy-1H-indol-3-yl)methylamino]-2-[3-(trifluoromethyl)phenyl]acetic acid (PubChem CID 70356145) has the molecular formula C19H17F3N2O3 and a molecular weight of 378.35 g/mol. Its IUPAC name is 2-[(5-methoxy-1H-indol-3-yl)methylamino]-2-[3-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | 2-[(5-methoxy-1H-indol-3-yl)methylamino]-2-[3-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 70356145 |
| Molecular Formula | C19H17F3N2O3 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-[(5-methoxy-1H-indol-3-yl)methylamino]-2-[3-(trifluoromethyl)phenyl]acetic acid |
| SMILES | COc1ccc2[nH]cc(CNC(C(=O)O)c3cccc(C(F)(F)F)c3)c2c1 |
| InChI | InChI=1S/C19H17F3N2O3/c1-27-14-5-6-16-15(8-14)12(9-23-16)10-24-17(18(25)26)11-3-2-4-13(7-11)19(20,21)22/h2-9,17,23-24H,10H2,1H3,(H,25,26) |
| InChIKey | NCJOZQRTPINMHO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |