C21H27N3O4 — CID 19797631
2-[4-(2-aminoethoxy)-3-nitrophenyl]-N-[3-(3,5-dimethylphenyl)propyl]acetamide (PubChem CID 19797631) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-[4-(2-aminoethoxy)-3-nitrophenyl]-N-[3-(3,5-dimethylphenyl)propyl]acetamide.
| Compound Name | 2-[4-(2-aminoethoxy)-3-nitrophenyl]-N-[3-(3,5-dimethylphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 19797631 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 2-[4-(2-aminoethoxy)-3-nitrophenyl]-N-[3-(3,5-dimethylphenyl)propyl]acetamide |
| SMILES | Cc1cc(C)cc(CCCNC(=O)Cc2ccc(OCCN)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C21H27N3O4/c1-15-10-16(2)12-17(11-15)4-3-8-23-21(25)14-18-5-6-20(28-9-7-22)19(13-18)24(26)27/h5-6,10-13H,3-4,7-9,14,22H2,1-2H3,(H,23,25) |
| InChIKey | XPXHHPOEMSBIFP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|