C26H31NO2 — CID 19800743
[4-(4-butylphenyl)phenyl] 1-cyano-3-ethylcyclohexane-1-carboxylate (PubChem CID 19800743) has the molecular formula C26H31NO2 and a molecular weight of 389.54 g/mol. Its IUPAC name is [4-(4-butylphenyl)phenyl] 1-cyano-3-ethylcyclohexane-1-carboxylate.
| Compound Name | [4-(4-butylphenyl)phenyl] 1-cyano-3-ethylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19800743 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | [4-(4-butylphenyl)phenyl] 1-cyano-3-ethylcyclohexane-1-carboxylate |
| SMILES | CCCCc1ccc(-c2ccc(OC(=O)C3(C#N)CCCC(CC)C3)cc2)cc1 |
| InChI | InChI=1S/C26H31NO2/c1-3-5-7-21-9-11-22(12-10-21)23-13-15-24(16-14-23)29-25(28)26(19-27)17-6-8-20(4-2)18-26/h9-16,20H,3-8,17-18H2,1-2H3 |
| InChIKey | NJZNCVHFKIXTKN-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|