C29H37NO2 — CID 70356122
1-cyano-3-ethyl-2-[4-(4-heptylphenyl)phenyl]cyclohexane-1-carboxylic acid (PubChem CID 70356122) has the molecular formula C29H37NO2 and a molecular weight of 431.62 g/mol. Its IUPAC name is 1-cyano-3-ethyl-2-[4-(4-heptylphenyl)phenyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-cyano-3-ethyl-2-[4-(4-heptylphenyl)phenyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 70356122 |
| Molecular Formula | C29H37NO2 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | 1-cyano-3-ethyl-2-[4-(4-heptylphenyl)phenyl]cyclohexane-1-carboxylic acid |
| SMILES | CCCCCCCc1ccc(-c2ccc(C3C(CC)CCCC3(C#N)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C29H37NO2/c1-3-5-6-7-8-10-22-12-14-24(15-13-22)25-16-18-26(19-17-25)27-23(4-2)11-9-20-29(27,21-30)28(31)32/h12-19,23,27H,3-11,20H2,1-2H3,(H,31,32) |
| InChIKey | IGZXWZBWDXYDDP-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|