C23H24ClNO3 — CID 154488974
3-chloro-1-cyano-2-[4-(4-propoxyphenyl)phenyl]cyclohexane-1-carboxylic acid (PubChem CID 154488974) has the molecular formula C23H24ClNO3 and a molecular weight of 397.90 g/mol. Its IUPAC name is 3-chloro-1-cyano-2-[4-(4-propoxyphenyl)phenyl]cyclohexane-1-carboxylic acid.
| Compound Name | 3-chloro-1-cyano-2-[4-(4-propoxyphenyl)phenyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 154488974 |
| Molecular Formula | C23H24ClNO3 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 3-chloro-1-cyano-2-[4-(4-propoxyphenyl)phenyl]cyclohexane-1-carboxylic acid |
| SMILES | CCCOc1ccc(-c2ccc(C3C(Cl)CCCC3(C#N)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C23H24ClNO3/c1-2-14-28-19-11-9-17(10-12-19)16-5-7-18(8-6-16)21-20(24)4-3-13-23(21,15-25)22(26)27/h5-12,20-21H,2-4,13-14H2,1H3,(H,26,27) |
| InChIKey | QKLUTMZXVSMMAR-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|