C24H26ClNO2 — CID 19800777
[4-(4-butylphenyl)phenyl] 3-chloro-1-cyanocyclohexane-1-carboxylate (PubChem CID 19800777) has the molecular formula C24H26ClNO2 and a molecular weight of 395.93 g/mol. Its IUPAC name is [4-(4-butylphenyl)phenyl] 3-chloro-1-cyanocyclohexane-1-carboxylate.
| Compound Name | [4-(4-butylphenyl)phenyl] 3-chloro-1-cyanocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19800777 |
| Molecular Formula | C24H26ClNO2 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | [4-(4-butylphenyl)phenyl] 3-chloro-1-cyanocyclohexane-1-carboxylate |
| SMILES | CCCCc1ccc(-c2ccc(OC(=O)C3(C#N)CCCC(Cl)C3)cc2)cc1 |
| InChI | InChI=1S/C24H26ClNO2/c1-2-3-5-18-7-9-19(10-8-18)20-11-13-22(14-12-20)28-23(27)24(17-26)15-4-6-21(25)16-24/h7-14,21H,2-6,15-16H2,1H3 |
| InChIKey | NCTGWIQHEISHQW-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|