C25H21NO3 — CID 19801726
2-benzyl-4-methyl-7-[(E)-3-phenylprop-2-enoyl]-4H-1,2-benzoxazin-3-one (PubChem CID 19801726) has the molecular formula C25H21NO3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-benzyl-4-methyl-7-[(E)-3-phenylprop-2-enoyl]-4H-1,2-benzoxazin-3-one.
| Compound Name | 2-benzyl-4-methyl-7-[(E)-3-phenylprop-2-enoyl]-4H-1,2-benzoxazin-3-one |
|---|---|
| PubChem CID | 19801726 |
| Molecular Formula | C25H21NO3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-benzyl-4-methyl-7-[(E)-3-phenylprop-2-enoyl]-4H-1,2-benzoxazin-3-one |
| SMILES | CC1C(=O)N(Cc2ccccc2)Oc2cc(C(=O)/C=C/c3ccccc3)ccc21 |
| InChI | InChI=1S/C25H21NO3/c1-18-22-14-13-21(23(27)15-12-19-8-4-2-5-9-19)16-24(22)29-26(25(18)28)17-20-10-6-3-7-11-20/h2-16,18H,17H2,1H3/b15-12+ |
| InChIKey | WSUBNCBCHFUTRY-NTCAYCPXSA-N |
| XLogP | 5.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|