C18H15NO4 — CID 54472714
7-[3-(4-hydroxyphenyl)prop-2-enoyl]-4-methyl-4H-1,2-benzoxazin-3-one (PubChem CID 54472714) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is 7-[3-(4-hydroxyphenyl)prop-2-enoyl]-4-methyl-4H-1,2-benzoxazin-3-one.
| Compound Name | 7-[3-(4-hydroxyphenyl)prop-2-enoyl]-4-methyl-4H-1,2-benzoxazin-3-one |
|---|---|
| PubChem CID | 54472714 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 7-[3-(4-hydroxyphenyl)prop-2-enoyl]-4-methyl-4H-1,2-benzoxazin-3-one |
| SMILES | CC1C(=O)NOc2cc(C(=O)C=Cc3ccc(O)cc3)ccc21 |
| InChI | InChI=1S/C18H15NO4/c1-11-15-8-5-13(10-17(15)23-19-18(11)22)16(21)9-4-12-2-6-14(20)7-3-12/h2-11,20H,1H3,(H,19,22) |
| InChIKey | XJKWJFJFXYFDGR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|