C18H32O2 — CID 19803362
5-butan-2-yl-2-(2,4-dimethylcyclohex-3-en-1-yl)-2,5-dimethyl-1,3-dioxane (PubChem CID 19803362) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is 5-butan-2-yl-2-(2,4-dimethylcyclohex-3-en-1-yl)-2,5-dimethyl-1,3-dioxane.
| Compound Name | 5-butan-2-yl-2-(2,4-dimethylcyclohex-3-en-1-yl)-2,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 19803362 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 5-butan-2-yl-2-(2,4-dimethylcyclohex-3-en-1-yl)-2,5-dimethyl-1,3-dioxane |
| SMILES | CCC(C)C1(C)COC(C)(C2CCC(C)=CC2C)OC1 |
| InChI | InChI=1S/C18H32O2/c1-7-15(4)17(5)11-19-18(6,20-12-17)16-9-8-13(2)10-14(16)3/h10,14-16H,7-9,11-12H2,1-6H3 |
| InChIKey | MOZXWQXFETUNET-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|