C17H30O2 — CID 19803380
2-(2,4-dimethylcyclohex-3-en-1-yl)-2,5-dimethyl-5-propyl-1,3-dioxane (PubChem CID 19803380) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is 2-(2,4-dimethylcyclohex-3-en-1-yl)-2,5-dimethyl-5-propyl-1,3-dioxane.
| Compound Name | 2-(2,4-dimethylcyclohex-3-en-1-yl)-2,5-dimethyl-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 19803380 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 2-(2,4-dimethylcyclohex-3-en-1-yl)-2,5-dimethyl-5-propyl-1,3-dioxane |
| SMILES | CCCC1(C)COC(C)(C2CCC(C)=CC2C)OC1 |
| InChI | InChI=1S/C17H30O2/c1-6-9-16(4)11-18-17(5,19-12-16)15-8-7-13(2)10-14(15)3/h10,14-15H,6-9,11-12H2,1-5H3 |
| InChIKey | SNBCDBIRQSYRPI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|