C16H21NO4 — CID 19808736
2-(3,3-dimethoxyprop-1-en-2-yl)-5-methoxy-1-(methoxymethyl)indole (PubChem CID 19808736) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-(3,3-dimethoxyprop-1-en-2-yl)-5-methoxy-1-(methoxymethyl)indole.
| Compound Name | 2-(3,3-dimethoxyprop-1-en-2-yl)-5-methoxy-1-(methoxymethyl)indole |
|---|---|
| PubChem CID | 19808736 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-(3,3-dimethoxyprop-1-en-2-yl)-5-methoxy-1-(methoxymethyl)indole |
| SMILES | C=C(c1cc2cc(OC)ccc2n1COC)C(OC)OC |
| InChI | InChI=1S/C16H21NO4/c1-11(16(20-4)21-5)15-9-12-8-13(19-3)6-7-14(12)17(15)10-18-2/h6-9,16H,1,10H2,2-5H3 |
| InChIKey | MHFMAOOQIWNEKW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|