C12H11FN4O4 — CID 19810608
6-fluoro-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-2-carbohydrazide (PubChem CID 19810608) has the molecular formula C12H11FN4O4 and a molecular weight of 294.24 g/mol. Its IUPAC name is 6-fluoro-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-2-carbohydrazide.
| Compound Name | 6-fluoro-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-2-carbohydrazide |
|---|---|
| PubChem CID | 19810608 |
| Molecular Formula | C12H11FN4O4 |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 6-fluoro-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-2-carbohydrazide |
| SMILES | NNC(=O)C1CC2(NC(=O)NC2=O)c2cc(F)ccc2O1 |
| InChI | InChI=1S/C12H11FN4O4/c13-5-1-2-7-6(3-5)12(10(19)15-11(20)16-12)4-8(21-7)9(18)17-14/h1-3,8H,4,14H2,(H,17,18)(H2,15,16,19,20) |
| InChIKey | VRYSSOHVHYMNKL-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|