C19H21ClFNO2 — CID 19812592
5-(5-butyl-1,3-dioxan-2-yl)-2-(4-chloro-3-fluorophenyl)pyridine (PubChem CID 19812592) has the molecular formula C19H21ClFNO2 and a molecular weight of 349.83 g/mol. Its IUPAC name is 5-(5-butyl-1,3-dioxan-2-yl)-2-(4-chloro-3-fluorophenyl)pyridine.
| Compound Name | 5-(5-butyl-1,3-dioxan-2-yl)-2-(4-chloro-3-fluorophenyl)pyridine |
|---|---|
| PubChem CID | 19812592 |
| Molecular Formula | C19H21ClFNO2 |
| Molecular Weight | 349.83 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 5-(5-butyl-1,3-dioxan-2-yl)-2-(4-chloro-3-fluorophenyl)pyridine |
| SMILES | CCCCC1COC(c2ccc(-c3ccc(Cl)c(F)c3)nc2)OC1 |
| InChI | InChI=1S/C19H21ClFNO2/c1-2-3-4-13-11-23-19(24-12-13)15-6-8-18(22-10-15)14-5-7-16(20)17(21)9-14/h5-10,13,19H,2-4,11-12H2,1H3 |
| InChIKey | HKPIQIVXSIJOSD-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.83 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |