C21H21Cl2NO2S — CID 170414499
5-butyl-2-[4-(3,5-dichloro-4-isothiocyanatophenyl)phenyl]-1,3-dioxane (PubChem CID 170414499) has the molecular formula C21H21Cl2NO2S and a molecular weight of 422.38 g/mol. Its IUPAC name is 5-butyl-2-[4-(3,5-dichloro-4-isothiocyanatophenyl)phenyl]-1,3-dioxane.
| Compound Name | 5-butyl-2-[4-(3,5-dichloro-4-isothiocyanatophenyl)phenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 170414499 |
| Molecular Formula | C21H21Cl2NO2S |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 5-butyl-2-[4-(3,5-dichloro-4-isothiocyanatophenyl)phenyl]-1,3-dioxane |
| SMILES | CCCCC1COC(c2ccc(-c3cc(Cl)c(N=C=S)c(Cl)c3)cc2)OC1 |
| InChI | InChI=1S/C21H21Cl2NO2S/c1-2-3-4-14-11-25-21(26-12-14)16-7-5-15(6-8-16)17-9-18(22)20(24-13-27)19(23)10-17/h5-10,14,21H,2-4,11-12H2,1H3 |
| InChIKey | GOEQAOQNWXQOFK-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|