About ethenyl(triethyl)silane carbonate
ethenyl(triethyl)silane carbonate (PubChem CID 19812768) has the molecular formula C9H18O3Si-2
and a molecular weight of 202.33 g/mol. Its IUPAC name is ethenyl(triethyl)silane carbonate.
Molecular Properties
| Compound Name | ethenyl(triethyl)silane carbonate |
| PubChem CID | 19812768 |
| Molecular Formula | C9H18O3Si-2 |
| Molecular Weight | 202.33 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | ethenyl(triethyl)silane carbonate |
| SMILES | C=C[Si](CC)(CC)CC.O=C([O-])[O-] |
| InChI | InChI=1S/C8H18Si.CH2O3/c1-5-9(6-2,7-3)8-4;2-1(3)4/h5H,1,6-8H2,2-4H3;(H2,2,3,4)/p-2 |
| InChIKey | ZKRYQHHCLZCCAU-UHFFFAOYSA-L |
| XLogP | 0.77 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenyl(triethyl)silane carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl(triethyl)silane carbonate?
The IUPAC name of ethenyl(triethyl)silane carbonate (CID 19812768) is ethenyl(triethyl)silane carbonate.
What is the SMILES notation for ethenyl(triethyl)silane carbonate?
The canonical SMILES for ethenyl(triethyl)silane carbonate is C=C[Si](CC)(CC)CC.O=C([O-])[O-].
What is the InChIKey of ethenyl(triethyl)silane carbonate?
The InChIKey is ZKRYQHHCLZCCAU-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H18Si.CH2O3/c1-5-9(6-2,7-3)8-4;2-1(3)4/h5H,1,6-8H2,2-4H3;(H2,2,3,4)/p-2.
What are the key properties of ethenyl(triethyl)silane carbonate?
ethenyl(triethyl)silane carbonate has a molecular weight of 202.33 g/mol, XLogP of 0.77, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl(triethyl)silane carbonate is sourced from PubChem (CID 19812768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).