C18H27NS — CID 19813294
N,N-dipropyl-2-(1,2,3,4-tetrahydronaphthalen-1-yl)ethanethioamide (PubChem CID 19813294) has the molecular formula C18H27NS and a molecular weight of 289.49 g/mol. Its IUPAC name is N,N-dipropyl-2-(1,2,3,4-tetrahydronaphthalen-1-yl)ethanethioamide.
| Compound Name | N,N-dipropyl-2-(1,2,3,4-tetrahydronaphthalen-1-yl)ethanethioamide |
|---|---|
| PubChem CID | 19813294 |
| Molecular Formula | C18H27NS |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | N,N-dipropyl-2-(1,2,3,4-tetrahydronaphthalen-1-yl)ethanethioamide |
| SMILES | CCCN(CCC)C(=S)CC1CCCc2ccccc21 |
| InChI | InChI=1S/C18H27NS/c1-3-12-19(13-4-2)18(20)14-16-10-7-9-15-8-5-6-11-17(15)16/h5-6,8,11,16H,3-4,7,9-10,12-14H2,1-2H3 |
| InChIKey | ODJAZOOJPZZGEV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|