C16H18O6P2 — CID 19814142
[(E)-4-(4-phenylphenyl)-1-phosphonobut-3-enyl]phosphonic acid (PubChem CID 19814142) has the molecular formula C16H18O6P2 and a molecular weight of 368.26 g/mol. Its IUPAC name is [(E)-4-(4-phenylphenyl)-1-phosphonobut-3-enyl]phosphonic acid.
| Compound Name | [(E)-4-(4-phenylphenyl)-1-phosphonobut-3-enyl]phosphonic acid |
|---|---|
| PubChem CID | 19814142 |
| Molecular Formula | C16H18O6P2 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | [(E)-4-(4-phenylphenyl)-1-phosphonobut-3-enyl]phosphonic acid |
| SMILES | O=P(O)(O)C(C/C=C/c1ccc(-c2ccccc2)cc1)P(=O)(O)O |
| InChI | InChI=1S/C16H18O6P2/c17-23(18,19)16(24(20,21)22)8-4-5-13-9-11-15(12-10-13)14-6-2-1-3-7-14/h1-7,9-12,16H,8H2,(H2,17,18,19)(H2,20,21,22)/b5-4+ |
| InChIKey | PNOWNFDBSISGRZ-SNAWJCMRSA-N |
| XLogP | 3.44 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|