C9H12NO3P — CID 71653547
[(E,1S)-1-amino-3-phenylprop-2-enyl]phosphonic acid (PubChem CID 71653547) has the molecular formula C9H12NO3P and a molecular weight of 213.17 g/mol. Its IUPAC name is [(E,1S)-1-amino-3-phenylprop-2-enyl]phosphonic acid.
| Compound Name | [(E,1S)-1-amino-3-phenylprop-2-enyl]phosphonic acid |
|---|---|
| PubChem CID | 71653547 |
| Molecular Formula | C9H12NO3P |
| Molecular Weight | 213.17 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | [(E,1S)-1-amino-3-phenylprop-2-enyl]phosphonic acid |
| SMILES | N[C@H](/C=C/c1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C9H12NO3P/c10-9(14(11,12)13)7-6-8-4-2-1-3-5-8/h1-7,9H,10H2,(H2,11,12,13)/b7-6+/t9-/m0/s1 |
| InChIKey | GBKOYBLDFDFKTA-UCUJLANTSA-N |
| XLogP | 1.16 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.17 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|