C67H136O10 — CID 19814918
13,13-bis[12-hydroxy-9-(3-hydroxypropyl)dodecyl]-4,4,22,22-tetrakis(3-hydroxypropyl)pentacosane-1,25-diol (PubChem CID 19814918) has the molecular formula C67H136O10 and a molecular weight of 1101.81 g/mol. Its IUPAC name is 13,13-bis[12-hydroxy-9-(3-hydroxypropyl)dodecyl]-4,4,22,22-tetrakis(3-hydroxypropyl)pentacosane-1,25-diol.
| Compound Name | 13,13-bis[12-hydroxy-9-(3-hydroxypropyl)dodecyl]-4,4,22,22-tetrakis(3-hydroxypropyl)pentacosane-1,25-diol |
|---|---|
| PubChem CID | 19814918 |
| Molecular Formula | C67H136O10 |
| Molecular Weight | 1101.81 g/mol |
| Exact Mass | 1101.01 |
| IUPAC Name | 13,13-bis[12-hydroxy-9-(3-hydroxypropyl)dodecyl]-4,4,22,22-tetrakis(3-hydroxypropyl)pentacosane-1,25-diol |
| SMILES | OCCCC(CCCO)CCCCCCCCC(CCCCCCCCC(CCCO)CCCO)(CCCCCCCCC(CCCO)(CCCO)CCCO)CCCCCCCCC(CCCO)(CCCO)CCCO |
| InChI | InChI=1S/C67H136O10/c68-53-25-37-63(38-26-54-69)35-17-9-1-3-11-19-41-65(42-20-12-4-2-10-18-36-64(39-27-55-70)40-28-56-71,43-21-13-5-7-15-23-45-66(47-29-57-72,48-30-58-73)49-31-59-74)44-22-14-6-8-16-24-46-67(50-32-60-75,51-33-61-76)52-34-62-77/h63-64,68-77H,1-62H2 |
| InChIKey | VWFSWBCJIWQHLR-UHFFFAOYSA-N |
| XLogP | 15.39 |
| TPSA | 202.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 66 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1101.81 |
| LogP ≤ 5 | 15.39 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|