C23H23N3O2S — CID 19817085
3-[3-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)propyl]-2λ6-thia-3,6-diazatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene 2,2-dioxide (PubChem CID 19817085) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is 3-[3-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)propyl]-2λ6-thia-3,6-diazatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene 2,2-dioxide.
| Compound Name | 3-[3-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)propyl]-2λ6-thia-3,6-diazatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene 2,2-dioxide |
|---|---|
| PubChem CID | 19817085 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 3-[3-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)propyl]-2λ6-thia-3,6-diazatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene 2,2-dioxide |
| SMILES | O=S1(=O)c2cccc3cncc(c23)N1CCCC1CC(c2ccccc2)=CCN1 |
| InChI | InChI=1S/C23H23N3O2S/c27-29(28)22-10-4-8-19-15-24-16-21(23(19)22)26(29)13-5-9-20-14-18(11-12-25-20)17-6-2-1-3-7-17/h1-4,6-8,10-11,15-16,20,25H,5,9,12-14H2 |
| InChIKey | FDSRNFTVWMZNCW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |