C26H27N3OS — CID 56998458
N-[3-[3-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)propyl]-2-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-7-yl]acetamide (PubChem CID 56998458) has the molecular formula C26H27N3OS and a molecular weight of 429.59 g/mol. Its IUPAC name is N-[3-[3-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)propyl]-2-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-7-yl]acetamide.
| Compound Name | N-[3-[3-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)propyl]-2-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-7-yl]acetamide |
|---|---|
| PubChem CID | 56998458 |
| Molecular Formula | C26H27N3OS |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | N-[3-[3-(4-phenyl-1,2,3,6-tetrahydropyridin-2-yl)propyl]-2-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-7-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c3c(cccc13)SN2CCCC1CC(c2ccccc2)=CCN1 |
| InChI | InChI=1S/C26H27N3OS/c1-18(30)28-23-12-13-24-26-22(23)10-5-11-25(26)31-29(24)16-6-9-21-17-20(14-15-27-21)19-7-3-2-4-8-19/h2-5,7-8,10-14,21,27H,6,9,15-17H2,1H3,(H,28,30) |
| InChIKey | BNZAALKNQHDFDH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|