C24H23F3N2O7 — CID 19818607
2-[5-[3-[4-acetyl-3-hydroxy-2-(3,3,3-trifluoropropyl)phenoxy]propoxy]-4-cyano-2-methylanilino]-2-oxoacetic acid (PubChem CID 19818607) has the molecular formula C24H23F3N2O7 and a molecular weight of 508.45 g/mol. Its IUPAC name is 2-[5-[3-[4-acetyl-3-hydroxy-2-(3,3,3-trifluoropropyl)phenoxy]propoxy]-4-cyano-2-methylanilino]-2-oxoacetic acid.
| Compound Name | 2-[5-[3-[4-acetyl-3-hydroxy-2-(3,3,3-trifluoropropyl)phenoxy]propoxy]-4-cyano-2-methylanilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 19818607 |
| Molecular Formula | C24H23F3N2O7 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 2-[5-[3-[4-acetyl-3-hydroxy-2-(3,3,3-trifluoropropyl)phenoxy]propoxy]-4-cyano-2-methylanilino]-2-oxoacetic acid |
| SMILES | CC(=O)c1ccc(OCCCOc2cc(NC(=O)C(=O)O)c(C)cc2C#N)c(CCC(F)(F)F)c1O |
| InChI | InChI=1S/C24H23F3N2O7/c1-13-10-15(12-28)20(11-18(13)29-22(32)23(33)34)36-9-3-8-35-19-5-4-16(14(2)30)21(31)17(19)6-7-24(25,26)27/h4-5,10-11,31H,3,6-9H2,1-2H3,(H,29,32)(H,33,34) |
| InChIKey | KZPVZLPUPYGEEB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 145.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|