C24H26F3NO7 — CID 19818577
2-[3-[5-[4-acetyl-3-hydroxy-2-(3,3,3-trifluoropropyl)phenoxy]pentoxy]anilino]-2-oxoacetic acid (PubChem CID 19818577) has the molecular formula C24H26F3NO7 and a molecular weight of 497.47 g/mol. Its IUPAC name is 2-[3-[5-[4-acetyl-3-hydroxy-2-(3,3,3-trifluoropropyl)phenoxy]pentoxy]anilino]-2-oxoacetic acid.
| Compound Name | 2-[3-[5-[4-acetyl-3-hydroxy-2-(3,3,3-trifluoropropyl)phenoxy]pentoxy]anilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 19818577 |
| Molecular Formula | C24H26F3NO7 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 2-[3-[5-[4-acetyl-3-hydroxy-2-(3,3,3-trifluoropropyl)phenoxy]pentoxy]anilino]-2-oxoacetic acid |
| SMILES | CC(=O)c1ccc(OCCCCCOc2cccc(NC(=O)C(=O)O)c2)c(CCC(F)(F)F)c1O |
| InChI | InChI=1S/C24H26F3NO7/c1-15(29)18-8-9-20(19(21(18)30)10-11-24(25,26)27)35-13-4-2-3-12-34-17-7-5-6-16(14-17)28-22(31)23(32)33/h5-9,14,30H,2-4,10-13H2,1H3,(H,28,31)(H,32,33) |
| InChIKey | RCDZSDWHYYSOHW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|