C14H15F3O4 — CID 88527316
1-[2-hydroxy-4-(oxiran-2-ylmethoxy)-3-(3,3,3-trifluoropropyl)phenyl]ethanone (PubChem CID 88527316) has the molecular formula C14H15F3O4 and a molecular weight of 304.26 g/mol. Its IUPAC name is 1-[2-hydroxy-4-(oxiran-2-ylmethoxy)-3-(3,3,3-trifluoropropyl)phenyl]ethanone.
| Compound Name | 1-[2-hydroxy-4-(oxiran-2-ylmethoxy)-3-(3,3,3-trifluoropropyl)phenyl]ethanone |
|---|---|
| PubChem CID | 88527316 |
| Molecular Formula | C14H15F3O4 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-[2-hydroxy-4-(oxiran-2-ylmethoxy)-3-(3,3,3-trifluoropropyl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCC2CO2)c(CCC(F)(F)F)c1O |
| InChI | InChI=1S/C14H15F3O4/c1-8(18)10-2-3-12(21-7-9-6-20-9)11(13(10)19)4-5-14(15,16)17/h2-3,9,19H,4-7H2,1H3 |
| InChIKey | BBALFHDHTGUKGS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|