C27H18F5NO4 — CID 19821226
[4-(1,2,3,3,3-pentafluoro-1-phenoxypropoxy)phenyl]-(4-pyridin-2-yloxyphenyl)methanone (PubChem CID 19821226) has the molecular formula C27H18F5NO4 and a molecular weight of 515.43 g/mol. Its IUPAC name is [4-(1,2,3,3,3-pentafluoro-1-phenoxypropoxy)phenyl]-(4-pyridin-2-yloxyphenyl)methanone.
| Compound Name | [4-(1,2,3,3,3-pentafluoro-1-phenoxypropoxy)phenyl]-(4-pyridin-2-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 19821226 |
| Molecular Formula | C27H18F5NO4 |
| Molecular Weight | 515.43 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | [4-(1,2,3,3,3-pentafluoro-1-phenoxypropoxy)phenyl]-(4-pyridin-2-yloxyphenyl)methanone |
| SMILES | O=C(c1ccc(Oc2ccccn2)cc1)c1ccc(OC(F)(Oc2ccccc2)C(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H18F5NO4/c28-25(26(29,30)31)27(32,36-21-6-2-1-3-7-21)37-22-15-11-19(12-16-22)24(34)18-9-13-20(14-10-18)35-23-8-4-5-17-33-23/h1-17,25H |
| InChIKey | VUMFWIANMSEKFH-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.43 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|