C25H32O7S — CID 19823449
2-(3-methoxy-5-methoxysulfanyl-4-propoxyphenyl)-5-(3,4,5-trimethoxyphenyl)cyclopentan-1-one (PubChem CID 19823449) has the molecular formula C25H32O7S and a molecular weight of 476.59 g/mol. Its IUPAC name is 2-(3-methoxy-5-methoxysulfanyl-4-propoxyphenyl)-5-(3,4,5-trimethoxyphenyl)cyclopentan-1-one.
| Compound Name | 2-(3-methoxy-5-methoxysulfanyl-4-propoxyphenyl)-5-(3,4,5-trimethoxyphenyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 19823449 |
| Molecular Formula | C25H32O7S |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 2-(3-methoxy-5-methoxysulfanyl-4-propoxyphenyl)-5-(3,4,5-trimethoxyphenyl)cyclopentan-1-one |
| SMILES | CCCOc1c(OC)cc(C2CCC(c3cc(OC)c(OC)c(OC)c3)C2=O)cc1SOC |
| InChI | InChI=1S/C25H32O7S/c1-7-10-32-25-21(29-4)13-16(14-22(25)33-31-6)18-9-8-17(23(18)26)15-11-19(27-2)24(30-5)20(12-15)28-3/h11-14,17-18H,7-10H2,1-6H3 |
| InChIKey | CLBUYJGTAFWOGW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|