C29H57N3 — CID 19826647
2,3-dicyclohexyl-1,1-bis(2-ethylhexyl)guanidine (PubChem CID 19826647) has the molecular formula C29H57N3 and a molecular weight of 447.80 g/mol. Its IUPAC name is 2,3-dicyclohexyl-1,1-bis(2-ethylhexyl)guanidine.
| Compound Name | 2,3-dicyclohexyl-1,1-bis(2-ethylhexyl)guanidine |
|---|---|
| PubChem CID | 19826647 |
| Molecular Formula | C29H57N3 |
| Molecular Weight | 447.80 g/mol |
| Exact Mass | 447.46 |
| IUPAC Name | 2,3-dicyclohexyl-1,1-bis(2-ethylhexyl)guanidine |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)/C(=N\C1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C29H57N3/c1-5-9-17-25(7-3)23-32(24-26(8-4)18-10-6-2)29(30-27-19-13-11-14-20-27)31-28-21-15-12-16-22-28/h25-28H,5-24H2,1-4H3,(H,30,31) |
| InChIKey | ARUMAPUIMXEAOB-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.80 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|