C6H4N2O — CID 19831830
[1,3]oxazolo[5,4-b]pyridine (PubChem CID 19831830) has the molecular formula C6H4N2O and a molecular weight of 120.11 g/mol. Its IUPAC name is [1,3]oxazolo[5,4-b]pyridine.
| Compound Name | [1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 19831830 |
| Molecular Formula | C6H4N2O |
| Molecular Weight | 120.11 g/mol |
| Exact Mass | 120.03 |
| IUPAC Name | [1,3]oxazolo[5,4-b]pyridine |
| SMILES | c1cnc2ocnc2c1 |
| InChI | InChI=1S/C6H4N2O/c1-2-5-6(7-3-1)9-4-8-5/h1-4H |
| InChIKey | BFPLMTPHDFFMTG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.11 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |