C7H6N4O — CID 19831989
5-(oxiran-2-yl)tetrazolo[1,5-a]pyridine (PubChem CID 19831989) has the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. Its IUPAC name is 5-(oxiran-2-yl)tetrazolo[1,5-a]pyridine.
| Compound Name | 5-(oxiran-2-yl)tetrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 19831989 |
| Molecular Formula | C7H6N4O |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 5-(oxiran-2-yl)tetrazolo[1,5-a]pyridine |
| SMILES | c1cc(C2CO2)n2nnnc2c1 |
| InChI | InChI=1S/C7H6N4O/c1-2-5(6-4-12-6)11-7(3-1)8-9-10-11/h1-3,6H,4H2 |
| InChIKey | ZAJHWCTUJGIWFS-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|