About (5-phenyltetrazolo[1,5-a]pyridin-6-yl) hypoiodite
(5-phenyltetrazolo[1,5-a]pyridin-6-yl) hypoiodite (PubChem CID 155206289) has the molecular formula C11H7IN4O
and a molecular weight of 338.11 g/mol. Its IUPAC name is (5-phenyltetrazolo[1,5-a]pyridin-6-yl) hypoiodite.
Molecular Properties
| Compound Name | (5-phenyltetrazolo[1,5-a]pyridin-6-yl) hypoiodite |
| PubChem CID | 155206289 |
| Molecular Formula | C11H7IN4O |
| Molecular Weight | 338.11 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | (5-phenyltetrazolo[1,5-a]pyridin-6-yl) hypoiodite |
| SMILES | IOc1ccc2nnnn2c1-c1ccccc1 |
| InChI | InChI=1S/C11H7IN4O/c12-17-9-6-7-10-13-14-15-16(10)11(9)8-4-2-1-3-5-8/h1-7H |
| InChIKey | NKBHGCRMLZPWJZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.11 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (5-phenyltetrazolo[1,5-a]pyridin-6-yl) hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-phenyltetrazolo[1,5-a]pyridin-6-yl) hypoiodite?
The IUPAC name of (5-phenyltetrazolo[1,5-a]pyridin-6-yl) hypoiodite (CID 155206289) is (5-phenyltetrazolo[1,5-a]pyridin-6-yl) hypoiodite.
What is the SMILES notation for (5-phenyltetrazolo[1,5-a]pyridin-6-yl) hypoiodite?
The canonical SMILES for (5-phenyltetrazolo[1,5-a]pyridin-6-yl) hypoiodite is IOc1ccc2nnnn2c1-c1ccccc1.
What is the InChIKey of (5-phenyltetrazolo[1,5-a]pyridin-6-yl) hypoiodite?
The InChIKey is NKBHGCRMLZPWJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7IN4O/c12-17-9-6-7-10-13-14-15-16(10)11(9)8-4-2-1-3-5-8/h1-7H.
What are the key properties of (5-phenyltetrazolo[1,5-a]pyridin-6-yl) hypoiodite?
(5-phenyltetrazolo[1,5-a]pyridin-6-yl) hypoiodite has a molecular weight of 338.11 g/mol, XLogP of 2.52, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-phenyltetrazolo[1,5-a]pyridin-6-yl) hypoiodite is sourced from PubChem (CID 155206289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).