C23H27FN2O3 — CID 19832136
benzyl 4-(2-fluoro-N-propanoylanilino)-3-methylpiperidine-1-carboxylate (PubChem CID 19832136) has the molecular formula C23H27FN2O3 and a molecular weight of 398.48 g/mol. Its IUPAC name is benzyl 4-(2-fluoro-N-propanoylanilino)-3-methylpiperidine-1-carboxylate.
| Compound Name | benzyl 4-(2-fluoro-N-propanoylanilino)-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 19832136 |
| Molecular Formula | C23H27FN2O3 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | benzyl 4-(2-fluoro-N-propanoylanilino)-3-methylpiperidine-1-carboxylate |
| SMILES | CCC(=O)N(c1ccccc1F)C1CCN(C(=O)OCc2ccccc2)CC1C |
| InChI | InChI=1S/C23H27FN2O3/c1-3-22(27)26(21-12-8-7-11-19(21)24)20-13-14-25(15-17(20)2)23(28)29-16-18-9-5-4-6-10-18/h4-12,17,20H,3,13-16H2,1-2H3 |
| InChIKey | RXKISICVNOXKKV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |