C25H28ClNO5S — CID 19835205
butyl 4-(2-chlorophenyl)-5-(4-methoxyphenyl)sulfonyl-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate (PubChem CID 19835205) has the molecular formula C25H28ClNO5S and a molecular weight of 490.02 g/mol. Its IUPAC name is butyl 4-(2-chlorophenyl)-5-(4-methoxyphenyl)sulfonyl-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate.
| Compound Name | butyl 4-(2-chlorophenyl)-5-(4-methoxyphenyl)sulfonyl-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 19835205 |
| Molecular Formula | C25H28ClNO5S |
| Molecular Weight | 490.02 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | butyl 4-(2-chlorophenyl)-5-(4-methoxyphenyl)sulfonyl-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCCCOC(=O)C1=C(C)NC(C)=C(S(=O)(=O)c2ccc(OC)cc2)C1c1ccccc1Cl |
| InChI | InChI=1S/C25H28ClNO5S/c1-5-6-15-32-25(28)22-16(2)27-17(3)24(23(22)20-9-7-8-10-21(20)26)33(29,30)19-13-11-18(31-4)12-14-19/h7-14,23,27H,5-6,15H2,1-4H3 |
| InChIKey | TUFVSBCURYAESL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.02 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|