C23H24O6S — CID 19835989
2-[2-[2-(benzenesulfonyl)-3-oxo-4-phenylbutyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid (PubChem CID 19835989) has the molecular formula C23H24O6S and a molecular weight of 428.51 g/mol. Its IUPAC name is 2-[2-[2-(benzenesulfonyl)-3-oxo-4-phenylbutyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid.
| Compound Name | 2-[2-[2-(benzenesulfonyl)-3-oxo-4-phenylbutyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 19835989 |
| Molecular Formula | C23H24O6S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 2-[2-[2-(benzenesulfonyl)-3-oxo-4-phenylbutyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid |
| SMILES | O=C(O)CC1C(CC(C(=O)Cc2ccccc2)S(=O)(=O)c2ccccc2)=CCC1O |
| InChI | InChI=1S/C23H24O6S/c24-20-12-11-17(19(20)15-23(26)27)14-22(21(25)13-16-7-3-1-4-8-16)30(28,29)18-9-5-2-6-10-18/h1-11,19-20,22,24H,12-15H2,(H,26,27) |
| InChIKey | BHTJNYJJEPNZKZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|