About 2-[2-(2-prop-2-enylbenzoyl)oxyethoxy]ethyl 2-prop-2-enylbenzoate
2-[2-(2-prop-2-enylbenzoyl)oxyethoxy]ethyl 2-prop-2-enylbenzoate (PubChem CID 19842449) has the molecular formula C24H26O5
and a molecular weight of 394.47 g/mol. Its IUPAC name is 2-[2-(2-prop-2-enylbenzoyl)oxyethoxy]ethyl 2-prop-2-enylbenzoate.
Molecular Properties
| Compound Name | 2-[2-(2-prop-2-enylbenzoyl)oxyethoxy]ethyl 2-prop-2-enylbenzoate |
| PubChem CID | 19842449 |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 2-[2-(2-prop-2-enylbenzoyl)oxyethoxy]ethyl 2-prop-2-enylbenzoate |
| SMILES | C=CCc1ccccc1C(=O)OCCOCCOC(=O)c1ccccc1CC=C |
| InChI | InChI=1S/C24H26O5/c1-3-9-19-11-5-7-13-21(19)23(25)28-17-15-27-16-18-29-24(26)22-14-8-6-12-20(22)10-4-2/h3-8,11-14H,1-2,9-10,15-18H2 |
| InChIKey | MGEGBLBKBLUZLD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-prop-2-enylbenzoyl)oxyethoxy]ethyl 2-prop-2-enylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-prop-2-enylbenzoyl)oxyethoxy]ethyl 2-prop-2-enylbenzoate?
The IUPAC name of 2-[2-(2-prop-2-enylbenzoyl)oxyethoxy]ethyl 2-prop-2-enylbenzoate (CID 19842449) is 2-[2-(2-prop-2-enylbenzoyl)oxyethoxy]ethyl 2-prop-2-enylbenzoate.
What is the SMILES notation for 2-[2-(2-prop-2-enylbenzoyl)oxyethoxy]ethyl 2-prop-2-enylbenzoate?
The canonical SMILES for 2-[2-(2-prop-2-enylbenzoyl)oxyethoxy]ethyl 2-prop-2-enylbenzoate is C=CCc1ccccc1C(=O)OCCOCCOC(=O)c1ccccc1CC=C.
What is the InChIKey of 2-[2-(2-prop-2-enylbenzoyl)oxyethoxy]ethyl 2-prop-2-enylbenzoate?
The InChIKey is MGEGBLBKBLUZLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26O5/c1-3-9-19-11-5-7-13-21(19)23(25)28-17-15-27-16-18-29-24(26)22-14-8-6-12-20(22)10-4-2/h3-8,11-14H,1-2,9-10,15-18H2.
What are the key properties of 2-[2-(2-prop-2-enylbenzoyl)oxyethoxy]ethyl 2-prop-2-enylbenzoate?
2-[2-(2-prop-2-enylbenzoyl)oxyethoxy]ethyl 2-prop-2-enylbenzoate has a molecular weight of 394.47 g/mol, XLogP of 4.17, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-prop-2-enylbenzoyl)oxyethoxy]ethyl 2-prop-2-enylbenzoate is sourced from PubChem (CID 19842449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).