C16H19IN2O3S — CID 19844897
N-(3-iodo-4-propoxyphenyl)-N-(pyridin-3-ylmethyl)methanesulfonamide (PubChem CID 19844897) has the molecular formula C16H19IN2O3S and a molecular weight of 446.31 g/mol. Its IUPAC name is N-(3-iodo-4-propoxyphenyl)-N-(pyridin-3-ylmethyl)methanesulfonamide.
| Compound Name | N-(3-iodo-4-propoxyphenyl)-N-(pyridin-3-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 19844897 |
| Molecular Formula | C16H19IN2O3S |
| Molecular Weight | 446.31 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | N-(3-iodo-4-propoxyphenyl)-N-(pyridin-3-ylmethyl)methanesulfonamide |
| SMILES | CCCOc1ccc(N(Cc2cccnc2)S(C)(=O)=O)cc1I |
| InChI | InChI=1S/C16H19IN2O3S/c1-3-9-22-16-7-6-14(10-15(16)17)19(23(2,20)21)12-13-5-4-8-18-11-13/h4-8,10-11H,3,9,12H2,1-2H3 |
| InChIKey | WELITTBSUGJXJE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|