C18H17Cl2NO2 — CID 19857944
3-[(2,4-dichlorophenyl)methoxy]-4-(1-hydroxybutyl)benzonitrile (PubChem CID 19857944) has the molecular formula C18H17Cl2NO2 and a molecular weight of 350.25 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methoxy]-4-(1-hydroxybutyl)benzonitrile.
| Compound Name | 3-[(2,4-dichlorophenyl)methoxy]-4-(1-hydroxybutyl)benzonitrile |
|---|---|
| PubChem CID | 19857944 |
| Molecular Formula | C18H17Cl2NO2 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methoxy]-4-(1-hydroxybutyl)benzonitrile |
| SMILES | CCCC(O)c1ccc(C#N)cc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H17Cl2NO2/c1-2-3-17(22)15-7-4-12(10-21)8-18(15)23-11-13-5-6-14(19)9-16(13)20/h4-9,17,22H,2-3,11H2,1H3 |
| InChIKey | MVCRFGLZJQHHKL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |